C38H41N5O9 — CID 100911055
[(2R,3R,4S,5S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(2-methoxyethoxy)-5-[5-methyl-2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-3-yl] acetate (PubChem CID 100911055) has the molecular formula C38H41N5O9 and a molecular weight of 711.77 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(2-methoxyethoxy)-5-[5-methyl-2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(2-methoxyethoxy)-5-[5-methyl-2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 100911055 |
| Molecular Formula | C38H41N5O9 |
| Molecular Weight | 711.77 g/mol |
| Exact Mass | 711.29 |
| IUPAC Name | [(2R,3R,4S,5S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-(2-methoxyethoxy)-5-[5-methyl-2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-3-yl] acetate |
| SMILES | COCCO[C@H]1[C@H](OC(C)=O)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@@H]1n1cc(C)c(-n2cncn2)nc1=O |
| InChI | InChI=1S/C38H41N5O9/c1-25-21-42(37(45)41-35(25)43-24-39-23-40-43)36-34(49-20-19-46-3)33(51-26(2)44)32(52-36)22-50-38(27-9-7-6-8-10-27,28-11-15-30(47-4)16-12-28)29-13-17-31(48-5)18-14-29/h6-18,21,23-24,32-34,36H,19-20,22H2,1-5H3/t32-,33-,34+,36+/m1/s1 |
| InChIKey | PRQKJSAQZWOBCG-RJUWYKDSSA-N |
| XLogP | 4.02 |
| TPSA | 147.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|