C26H34N2O4 — CID 100916996
methyl (3R,4Z)-4-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]imino-3-methyl-2,2-diphenylbutanoate (PubChem CID 100916996) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is methyl (3R,4Z)-4-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]imino-3-methyl-2,2-diphenylbutanoate.
| Compound Name | methyl (3R,4Z)-4-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]imino-3-methyl-2,2-diphenylbutanoate |
|---|---|
| PubChem CID | 100916996 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | methyl (3R,4Z)-4-[(2S)-2-(2-methoxyethoxymethyl)pyrrolidin-1-yl]imino-3-methyl-2,2-diphenylbutanoate |
| SMILES | COCCOC[C@@H]1CCCN1/N=C\[C@H](C)C(C(=O)OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34N2O4/c1-21(19-27-28-16-10-15-24(28)20-32-18-17-30-2)26(25(29)31-3,22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-9,11-14,19,21,24H,10,15-18,20H2,1-3H3/b27-19-/t21-,24-/m0/s1 |
| InChIKey | YYSRFDVAJJENQZ-QHDAZFBGSA-N |
| XLogP | 3.89 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|