C9H9NO2 — CID 100921923
(5S,6R)-5,6-dideuterioquinoline-5,6-diol (PubChem CID 100921923) has the molecular formula C9H9NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is (5S,6R)-5,6-dideuterioquinoline-5,6-diol.
| Compound Name | (5S,6R)-5,6-dideuterioquinoline-5,6-diol |
|---|---|
| PubChem CID | 100921923 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (5S,6R)-5,6-dideuterioquinoline-5,6-diol |
| SMILES | [2H][C@]1(O)c2cccnc2C=C[C@@]1([2H])O |
| InChI | InChI=1S/C9H9NO2/c11-8-4-3-7-6(9(8)12)2-1-5-10-7/h1-5,8-9,11-12H/t8-,9+/m1/s1/i8D,9D |
| InChIKey | RXMLUIZBBRMXFQ-WOPNSLFMSA-N |
| XLogP | 0.50 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |