C31H34N2O7 — CID 100923444
methyl 4-[(2S)-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]oxybenzoate (PubChem CID 100923444) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is methyl 4-[(2S)-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]oxybenzoate.
| Compound Name | methyl 4-[(2S)-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]oxybenzoate |
|---|---|
| PubChem CID | 100923444 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | methyl 4-[(2S)-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]oxybenzoate |
| SMILES | COC(=O)c1ccc(OC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H34N2O7/c1-21(2)18-27(30(36)40-25-16-14-24(15-17-25)29(35)38-3)32-28(34)26(19-22-10-6-4-7-11-22)33-31(37)39-20-23-12-8-5-9-13-23/h4-17,21,26-27H,18-20H2,1-3H3,(H,32,34)(H,33,37)/t26-,27-/m0/s1 |
| InChIKey | POLXZPALNXWVLE-SVBPBHIXSA-N |
| XLogP | 4.45 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|