C13H14O3 — CID 100924905
4,5-bis(hydroxymethyl)-2-phenylcyclopent-2-en-1-one (PubChem CID 100924905) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2-phenylcyclopent-2-en-1-one.
| Compound Name | 4,5-bis(hydroxymethyl)-2-phenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 100924905 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-phenylcyclopent-2-en-1-one |
| SMILES | O=C1C(c2ccccc2)=CC(CO)C1CO |
| InChI | InChI=1S/C13H14O3/c14-7-10-6-11(13(16)12(10)8-15)9-4-2-1-3-5-9/h1-6,10,12,14-15H,7-8H2 |
| InChIKey | AXOOLTLEEZRAFJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |