C29H50O8 — CID 100926206
9-[2,4-ditert-butyl-6-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenoxy]-7-hydroxynonanoic acid (PubChem CID 100926206) has the molecular formula C29H50O8 and a molecular weight of 526.71 g/mol. Its IUPAC name is 9-[2,4-ditert-butyl-6-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenoxy]-7-hydroxynonanoic acid.
| Compound Name | 9-[2,4-ditert-butyl-6-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenoxy]-7-hydroxynonanoic acid |
|---|---|
| PubChem CID | 100926206 |
| Molecular Formula | C29H50O8 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | 9-[2,4-ditert-butyl-6-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]phenoxy]-7-hydroxynonanoic acid |
| SMILES | CC(C)(C)c1cc(OCCOCCOCCO)c(OCCC(O)CCCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H50O8/c1-28(2,3)22-20-24(29(4,5)6)27(25(21-22)36-19-18-35-17-16-34-15-13-30)37-14-12-23(31)10-8-7-9-11-26(32)33/h20-21,23,30-31H,7-19H2,1-6H3,(H,32,33) |
| InChIKey | VLPJTJHRPZMNOX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|