C20H18N2 — CID 100928406
4,5-dimethylidene-2,6-bis(4-methylphenyl)pyrimidine (PubChem CID 100928406) has the molecular formula C20H18N2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 4,5-dimethylidene-2,6-bis(4-methylphenyl)pyrimidine.
| Compound Name | 4,5-dimethylidene-2,6-bis(4-methylphenyl)pyrimidine |
|---|---|
| PubChem CID | 100928406 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4,5-dimethylidene-2,6-bis(4-methylphenyl)pyrimidine |
| SMILES | C=c1nc(-c2ccc(C)cc2)nc(-c2ccc(C)cc2)c1=C |
| InChI | InChI=1S/C20H18N2/c1-13-5-9-17(10-6-13)19-15(3)16(4)21-20(22-19)18-11-7-14(2)8-12-18/h5-12H,3-4H2,1-2H3 |
| InChIKey | LNZGXNJIDXCGLR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |