C17H30O4Si — CID 100933489
tert-butyl-dimethyl-[[(1'R,4R,5S,5'R)-2,2,5-trimethylspiro[1,3-dioxolane-4,4'-6-oxabicyclo[3.1.0]hex-2-ene]-2'-yl]methoxy]silane (PubChem CID 100933489) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1'R,4R,5S,5'R)-2,2,5-trimethylspiro[1,3-dioxolane-4,4'-6-oxabicyclo[3.1.0]hex-2-ene]-2'-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1'R,4R,5S,5'R)-2,2,5-trimethylspiro[1,3-dioxolane-4,4'-6-oxabicyclo[3.1.0]hex-2-ene]-2'-yl]methoxy]silane |
|---|---|
| PubChem CID | 100933489 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(1'R,4R,5S,5'R)-2,2,5-trimethylspiro[1,3-dioxolane-4,4'-6-oxabicyclo[3.1.0]hex-2-ene]-2'-yl]methoxy]silane |
| SMILES | C[C@@H]1OC(C)(C)O[C@]12C=C(CO[Si](C)(C)C(C)(C)C)[C@H]1O[C@H]12 |
| InChI | InChI=1S/C17H30O4Si/c1-11-17(21-16(5,6)20-11)9-12(13-14(17)19-13)10-18-22(7,8)15(2,3)4/h9,11,13-14H,10H2,1-8H3/t11-,13+,14+,17+/m0/s1 |
| InChIKey | UTVYPFDFFJSPFY-ZCTGUTNYSA-N |
| XLogP | 3.63 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|