C27H23N3O6 — CID 100934345
[(1S)-1-phenylethyl] (3S,6R,7R)-3-methyl-5,10,12-trioxo-11-phenyl-4-oxa-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-6-carboxylate (PubChem CID 100934345) has the molecular formula C27H23N3O6 and a molecular weight of 485.50 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] (3S,6R,7R)-3-methyl-5,10,12-trioxo-11-phenyl-4-oxa-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-6-carboxylate.
| Compound Name | [(1S)-1-phenylethyl] (3S,6R,7R)-3-methyl-5,10,12-trioxo-11-phenyl-4-oxa-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-6-carboxylate |
|---|---|
| PubChem CID | 100934345 |
| Molecular Formula | C27H23N3O6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [(1S)-1-phenylethyl] (3S,6R,7R)-3-methyl-5,10,12-trioxo-11-phenyl-4-oxa-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-6-carboxylate |
| SMILES | CC1OC(=O)[C@]2(C(=O)O[C@@H](C)c3ccccc3)[C@@H]3C4C=CC(n5c(=O)n(-c6ccccc6)c(=O)n54)C132 |
| InChI | InChI=1S/C27H23N3O6/c1-15(17-9-5-3-6-10-17)35-22(31)27-21-19-13-14-20(26(21,27)16(2)36-23(27)32)30-25(34)28(24(33)29(19)30)18-11-7-4-8-12-18/h3-16,19-21H,1-2H3/t15-,16?,19?,20?,21+,26?,27+/m0/s1 |
| InChIKey | JLVMGTYZJPSCMY-NQQAYZRWSA-N |
| XLogP | 2.32 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|