C22H23N3O3 — CID 100934439
(3R,7R)-6-methyl-11-phenyl-3-propan-2-yl-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione (PubChem CID 100934439) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (3R,7R)-6-methyl-11-phenyl-3-propan-2-yl-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione.
| Compound Name | (3R,7R)-6-methyl-11-phenyl-3-propan-2-yl-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione |
|---|---|
| PubChem CID | 100934439 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (3R,7R)-6-methyl-11-phenyl-3-propan-2-yl-9,11,13-triazapentacyclo[6.5.2.02,6.02,7.09,13]pentadec-14-ene-5,10,12-trione |
| SMILES | CC(C)C1CC(=O)C2(C)[C@@H]3C4C=CC(n5c(=O)n(-c6ccccc6)c(=O)n54)C132 |
| InChI | InChI=1S/C22H23N3O3/c1-12(2)14-11-17(26)21(3)18-15-9-10-16(22(14,18)21)25-20(28)23(19(27)24(15)25)13-7-5-4-6-8-13/h4-10,12,14-16,18H,11H2,1-3H3/t14?,15?,16?,18-,21?,22?/m0/s1 |
| InChIKey | GRQLPQBVTLKYMJ-DDETVRHLSA-N |
| XLogP | 2.33 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|