C15H27NOSi — CID 100940214
tert-butyl-dimethyl-(4,5,6,7-tetrahydro-1H-indol-3-ylmethoxy)silane (PubChem CID 100940214) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-(4,5,6,7-tetrahydro-1H-indol-3-ylmethoxy)silane.
| Compound Name | tert-butyl-dimethyl-(4,5,6,7-tetrahydro-1H-indol-3-ylmethoxy)silane |
|---|---|
| PubChem CID | 100940214 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | tert-butyl-dimethyl-(4,5,6,7-tetrahydro-1H-indol-3-ylmethoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1c[nH]c2c1CCCC2 |
| InChI | InChI=1S/C15H27NOSi/c1-15(2,3)18(4,5)17-11-12-10-16-14-9-7-6-8-13(12)14/h10,16H,6-9,11H2,1-5H3 |
| InChIKey | KBCMGRBBWAACPJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|