C14H27N3OSi — CID 100941522
(E,3S)-3-amino-2-morpholin-4-yl-7-trimethylsilylhept-5-enenitrile (PubChem CID 100941522) has the molecular formula C14H27N3OSi and a molecular weight of 281.48 g/mol. Its IUPAC name is (E,3S)-3-amino-2-morpholin-4-yl-7-trimethylsilylhept-5-enenitrile.
| Compound Name | (E,3S)-3-amino-2-morpholin-4-yl-7-trimethylsilylhept-5-enenitrile |
|---|---|
| PubChem CID | 100941522 |
| Molecular Formula | C14H27N3OSi |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | (E,3S)-3-amino-2-morpholin-4-yl-7-trimethylsilylhept-5-enenitrile |
| SMILES | C[Si](C)(C)C/C=C/C[C@H](N)C(C#N)N1CCOCC1 |
| InChI | InChI=1S/C14H27N3OSi/c1-19(2,3)11-5-4-6-13(16)14(12-15)17-7-9-18-10-8-17/h4-5,13-14H,6-11,16H2,1-3H3/b5-4+/t13-,14?/m0/s1 |
| InChIKey | GOMINISDYSRMFW-VIJSAWSISA-N |
| XLogP | 1.82 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|