C39H56O6SSi2 — CID 100941789
tert-butyl-[[(2R,3S)-2-methyl-3-(4-methylphenyl)sulfonyl-3-[[(2R,3S)-3-triethylsilyloxyoxan-2-yl]methyl]oxiran-2-yl]methoxy]-diphenylsilane (PubChem CID 100941789) has the molecular formula C39H56O6SSi2 and a molecular weight of 709.11 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S)-2-methyl-3-(4-methylphenyl)sulfonyl-3-[[(2R,3S)-3-triethylsilyloxyoxan-2-yl]methyl]oxiran-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3S)-2-methyl-3-(4-methylphenyl)sulfonyl-3-[[(2R,3S)-3-triethylsilyloxyoxan-2-yl]methyl]oxiran-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 100941789 |
| Molecular Formula | C39H56O6SSi2 |
| Molecular Weight | 709.11 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | tert-butyl-[[(2R,3S)-2-methyl-3-(4-methylphenyl)sulfonyl-3-[[(2R,3S)-3-triethylsilyloxyoxan-2-yl]methyl]oxiran-2-yl]methoxy]-diphenylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCCO[C@@H]1C[C@@]1(S(=O)(=O)c2ccc(C)cc2)O[C@]1(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H56O6SSi2/c1-9-47(10-2,11-3)44-35-23-18-28-42-36(35)29-39(46(40,41)32-26-24-31(4)25-27-32)38(8,45-39)30-43-48(37(5,6)7,33-19-14-12-15-20-33)34-21-16-13-17-22-34/h12-17,19-22,24-27,35-36H,9-11,18,23,28-30H2,1-8H3/t35-,36+,38+,39-/m0/s1 |
| InChIKey | FLJMYBDTBVZVHX-OVKKXVLKSA-N |
| XLogP | 7.79 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.11 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|