C13H9BrN2PS+ — CID 100943721
5-(4-bromophenyl)-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium (PubChem CID 100943721) has the molecular formula C13H9BrN2PS+ and a molecular weight of 336.17 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium.
| Compound Name | 5-(4-bromophenyl)-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium |
|---|---|
| PubChem CID | 100943721 |
| Molecular Formula | C13H9BrN2PS+ |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 334.94 |
| IUPAC Name | 5-(4-bromophenyl)-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium |
| SMILES | Brc1ccc(-c2n[n+](-c3ccccc3)ps2)cc1 |
| InChI | InChI=1S/C13H9BrN2PS/c14-11-8-6-10(7-9-11)13-15-16(17-18-13)12-4-2-1-3-5-12/h1-9H/q+1 |
| InChIKey | YJXYSHKGACQVGJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |