C9H10N2PS+ — CID 100943731
5-ethyl-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium (PubChem CID 100943731) has the molecular formula C9H10N2PS+ and a molecular weight of 209.23 g/mol. Its IUPAC name is 5-ethyl-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium.
| Compound Name | 5-ethyl-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium |
|---|---|
| PubChem CID | 100943731 |
| Molecular Formula | C9H10N2PS+ |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 5-ethyl-3-phenyl-1,3,4,2-thiadiazaphosphol-3-ium |
| SMILES | CCc1n[n+](-c2ccccc2)ps1 |
| InChI | InChI=1S/C9H10N2PS/c1-2-9-10-11(12-13-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3/q+1 |
| InChIKey | DXKGPRQUCXEMKI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |