C26H50GeO4 — CID 100944149
diethyl (2R,3R,4R)-2,3-dimethyl-4-(tributylgermylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 100944149) has the molecular formula C26H50GeO4 and a molecular weight of 499.29 g/mol. Its IUPAC name is diethyl (2R,3R,4R)-2,3-dimethyl-4-(tributylgermylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (2R,3R,4R)-2,3-dimethyl-4-(tributylgermylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 100944149 |
| Molecular Formula | C26H50GeO4 |
| Molecular Weight | 499.29 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | diethyl (2R,3R,4R)-2,3-dimethyl-4-(tributylgermylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCCC[Ge](CCCC)(CCCC)C[C@@H]1CC(C(=O)OCC)(C(=O)OCC)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C26H50GeO4/c1-8-13-16-27(17-14-9-2,18-15-10-3)20-23-19-26(22(7)21(23)6,24(28)30-11-4)25(29)31-12-5/h21-23H,8-20H2,1-7H3/t21-,22-,23+/m1/s1 |
| InChIKey | DVGYUQSCDSXHDM-ZLNRFVROSA-N |
| XLogP | 7.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.29 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|