C54H54N2O4 — CID 100946025
[4-[5-[4-(4-aminophenoxy)benzoyl]-1,3-dicyclohexyl-3-methyl-2H-inden-1-yl]phenyl]-[4-(4-aminophenoxy)phenyl]methanone (PubChem CID 100946025) has the molecular formula C54H54N2O4 and a molecular weight of 795.04 g/mol. Its IUPAC name is [4-[5-[4-(4-aminophenoxy)benzoyl]-1,3-dicyclohexyl-3-methyl-2H-inden-1-yl]phenyl]-[4-(4-aminophenoxy)phenyl]methanone.
| Compound Name | [4-[5-[4-(4-aminophenoxy)benzoyl]-1,3-dicyclohexyl-3-methyl-2H-inden-1-yl]phenyl]-[4-(4-aminophenoxy)phenyl]methanone |
|---|---|
| PubChem CID | 100946025 |
| Molecular Formula | C54H54N2O4 |
| Molecular Weight | 795.04 g/mol |
| Exact Mass | 794.41 |
| IUPAC Name | [4-[5-[4-(4-aminophenoxy)benzoyl]-1,3-dicyclohexyl-3-methyl-2H-inden-1-yl]phenyl]-[4-(4-aminophenoxy)phenyl]methanone |
| SMILES | CC1(C2CCCCC2)CC(c2ccc(C(=O)c3ccc(Oc4ccc(N)cc4)cc3)cc2)(C2CCCCC2)c2ccc(C(=O)c3ccc(Oc4ccc(N)cc4)cc3)cc21 |
| InChI | InChI=1S/C54H54N2O4/c1-53(40-8-4-2-5-9-40)35-54(41-10-6-3-7-11-41,42-19-12-36(13-20-42)51(57)37-14-25-45(26-15-37)59-47-29-21-43(55)22-30-47)49-33-18-39(34-50(49)53)52(58)38-16-27-46(28-17-38)60-48-31-23-44(56)24-32-48/h12-34,40-41H,2-11,35,55-56H2,1H3 |
| InChIKey | SVHGKPKPOCFSEI-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.04 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|