C20H31N — CID 138601617
8-cycloundecyl-8-methylbicyclo[4.2.0]octa-1(6),2,4-trien-3-amine (PubChem CID 138601617) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is 8-cycloundecyl-8-methylbicyclo[4.2.0]octa-1(6),2,4-trien-3-amine.
| Compound Name | 8-cycloundecyl-8-methylbicyclo[4.2.0]octa-1(6),2,4-trien-3-amine |
|---|---|
| PubChem CID | 138601617 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 8-cycloundecyl-8-methylbicyclo[4.2.0]octa-1(6),2,4-trien-3-amine |
| SMILES | CC1(C2CCCCCCCCCC2)Cc2ccc(N)cc21 |
| InChI | InChI=1S/C20H31N/c1-20(15-16-12-13-18(21)14-19(16)20)17-10-8-6-4-2-3-5-7-9-11-17/h12-14,17H,2-11,15,21H2,1H3 |
| InChIKey | XLEYEMNSBHIYHW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|