C27H32N2O8 — CID 100953302
(3R,4S,5S)-2-benzyl-4-nitro-3-phenyl-5-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine (PubChem CID 100953302) has the molecular formula C27H32N2O8 and a molecular weight of 512.56 g/mol. Its IUPAC name is (3R,4S,5S)-2-benzyl-4-nitro-3-phenyl-5-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine.
| Compound Name | (3R,4S,5S)-2-benzyl-4-nitro-3-phenyl-5-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 100953302 |
| Molecular Formula | C27H32N2O8 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (3R,4S,5S)-2-benzyl-4-nitro-3-phenyl-5-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3ON(Cc4ccccc4)[C@H](c4ccccc4)[C@@H]3[N+](=O)[O-])O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C27H32N2O8/c1-26(2)33-22-21(32-25-24(23(22)34-26)35-27(3,4)36-25)20-19(29(30)31)18(17-13-9-6-10-14-17)28(37-20)15-16-11-7-5-8-12-16/h5-14,18-25H,15H2,1-4H3/t18-,19+,20+,21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | XEIKILVNSWWUEG-KEZXODKSSA-N |
| XLogP | 3.59 |
| TPSA | 101.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|