C25H28O6 — CID 100959334
3,9-bis[[4-(oxiran-2-yl)phenyl]methyl]-1,5,7,11-tetraoxaspiro[5.5]undecane (PubChem CID 100959334) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 3,9-bis[[4-(oxiran-2-yl)phenyl]methyl]-1,5,7,11-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,9-bis[[4-(oxiran-2-yl)phenyl]methyl]-1,5,7,11-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 100959334 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3,9-bis[[4-(oxiran-2-yl)phenyl]methyl]-1,5,7,11-tetraoxaspiro[5.5]undecane |
| SMILES | c1cc(C2CO2)ccc1CC1COC2(OC1)OCC(Cc1ccc(C3CO3)cc1)CO2 |
| InChI | InChI=1S/C25H28O6/c1-5-21(23-15-26-23)6-2-17(1)9-19-11-28-25(29-12-19)30-13-20(14-31-25)10-18-3-7-22(8-4-18)24-16-27-24/h1-8,19-20,23-24H,9-16H2 |
| InChIKey | DSSGDFVRKSDSKT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|