C25H24N2O7 — CID 10095971
4-(4-methoxyphenyl)-1-[5-(4-methoxyphenyl)-1,2,4,3-trioxazolidin-3-yl]-3-phenylmethoxyazetidin-2-one (PubChem CID 10095971) has the molecular formula C25H24N2O7 and a molecular weight of 464.47 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-[5-(4-methoxyphenyl)-1,2,4,3-trioxazolidin-3-yl]-3-phenylmethoxyazetidin-2-one.
| Compound Name | 4-(4-methoxyphenyl)-1-[5-(4-methoxyphenyl)-1,2,4,3-trioxazolidin-3-yl]-3-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 10095971 |
| Molecular Formula | C25H24N2O7 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-[5-(4-methoxyphenyl)-1,2,4,3-trioxazolidin-3-yl]-3-phenylmethoxyazetidin-2-one |
| SMILES | COc1ccc(C2OON(N3C(=O)C(OCc4ccccc4)C3c3ccc(OC)cc3)O2)cc1 |
| InChI | InChI=1S/C25H24N2O7/c1-29-20-12-8-18(9-13-20)22-23(31-16-17-6-4-3-5-7-17)24(28)26(22)27-32-25(33-34-27)19-10-14-21(30-2)15-11-19/h3-15,22-23,25H,16H2,1-2H3 |
| InChIKey | UYMZYOGRZWZSDN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|