C14H26Br2O2Se — CID 10096016
trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-methoxycyclohexyl]-λ4-selanyl]-2-methoxycyclohexane (PubChem CID 10096016) has the molecular formula C14H26Br2O2Se and a molecular weight of 465.13 g/mol. Its IUPAC name is trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-methoxycyclohexyl]-λ4-selanyl]-2-methoxycyclohexane.
| Compound Name | trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-methoxycyclohexyl]-λ4-selanyl]-2-methoxycyclohexane |
|---|---|
| PubChem CID | 10096016 |
| Molecular Formula | C14H26Br2O2Se |
| Molecular Weight | 465.13 g/mol |
| Exact Mass | 463.95 |
| IUPAC Name | trans-(1R,2R)-1-[dibromo-[(1S,2S)-2-methoxycyclohexyl]-λ4-selanyl]-2-methoxycyclohexane |
| SMILES | CO[C@H]1CCCC[C@@H]1[Se](Br)(Br)[C@@H]1CCCC[C@H]1OC |
| InChI | InChI=1S/C14H26Br2O2Se/c1-17-11-7-3-5-9-13(11)19(15,16)14-10-6-4-8-12(14)18-2/h11-14H,3-10H2,1-2H3/t11-,12+,13-,14+ |
| InChIKey | MLMKCKCZBURMGP-KPWCQOOUSA-N |
| XLogP | 5.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.13 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|