C27H32NO4P — CID 10096038
methyl (2R,3S,4R)-2-(benzylamino)-4-diphenylphosphoryl-3-hydroxy-5-methylhexanoate (PubChem CID 10096038) has the molecular formula C27H32NO4P and a molecular weight of 465.53 g/mol. Its IUPAC name is methyl (2R,3S,4R)-2-(benzylamino)-4-diphenylphosphoryl-3-hydroxy-5-methylhexanoate.
| Compound Name | methyl (2R,3S,4R)-2-(benzylamino)-4-diphenylphosphoryl-3-hydroxy-5-methylhexanoate |
|---|---|
| PubChem CID | 10096038 |
| Molecular Formula | C27H32NO4P |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | methyl (2R,3S,4R)-2-(benzylamino)-4-diphenylphosphoryl-3-hydroxy-5-methylhexanoate |
| SMILES | COC(=O)[C@H](NCc1ccccc1)[C@H](O)[C@@H](C(C)C)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32NO4P/c1-20(2)26(25(29)24(27(30)32-3)28-19-21-13-7-4-8-14-21)33(31,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h4-18,20,24-26,28-29H,19H2,1-3H3/t24-,25+,26-/m1/s1 |
| InChIKey | XNYHAUBIVXOXNI-UODIDJSMSA-N |
| XLogP | 3.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|