C30H37NO5 — CID 134966687
methyl (2S,3S)-2-(benzhydrylamino)-4,4-diethoxy-3-hydroxy-6-phenylhexanoate (PubChem CID 134966687) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is methyl (2S,3S)-2-(benzhydrylamino)-4,4-diethoxy-3-hydroxy-6-phenylhexanoate.
| Compound Name | methyl (2S,3S)-2-(benzhydrylamino)-4,4-diethoxy-3-hydroxy-6-phenylhexanoate |
|---|---|
| PubChem CID | 134966687 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | methyl (2S,3S)-2-(benzhydrylamino)-4,4-diethoxy-3-hydroxy-6-phenylhexanoate |
| SMILES | CCOC(CCc1ccccc1)(OCC)[C@@H](O)[C@H](NC(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C30H37NO5/c1-4-35-30(36-5-2,22-21-23-15-9-6-10-16-23)28(32)27(29(33)34-3)31-26(24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,26-28,31-32H,4-5,21-22H2,1-3H3/t27-,28-/m0/s1 |
| InChIKey | SKEJECTZGWHGRL-NSOVKSMOSA-N |
| XLogP | 4.67 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|