C25H37NO4Si — CID 134949512
methyl (2S,3S,4S)-2-(benzhydrylamino)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanoate (PubChem CID 134949512) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is methyl (2S,3S,4S)-2-(benzhydrylamino)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanoate.
| Compound Name | methyl (2S,3S,4S)-2-(benzhydrylamino)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanoate |
|---|---|
| PubChem CID | 134949512 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | methyl (2S,3S,4S)-2-(benzhydrylamino)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanoate |
| SMILES | COC(=O)[C@@H](NC(c1ccccc1)c1ccccc1)[C@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H37NO4Si/c1-18(30-31(6,7)25(2,3)4)23(27)22(24(28)29-5)26-21(19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-18,21-23,26-27H,1-7H3/t18-,22-,23+/m0/s1 |
| InChIKey | PZSYJDXBBGOWQX-OFAXGOBFSA-N |
| XLogP | 4.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|