C25H33NO5 — CID 134949511
methyl (2S,3S)-2-(benzhydrylamino)-4,4-diethoxy-3-hydroxyhept-6-enoate (PubChem CID 134949511) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is methyl (2S,3S)-2-(benzhydrylamino)-4,4-diethoxy-3-hydroxyhept-6-enoate.
| Compound Name | methyl (2S,3S)-2-(benzhydrylamino)-4,4-diethoxy-3-hydroxyhept-6-enoate |
|---|---|
| PubChem CID | 134949511 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | methyl (2S,3S)-2-(benzhydrylamino)-4,4-diethoxy-3-hydroxyhept-6-enoate |
| SMILES | C=CCC(OCC)(OCC)[C@@H](O)[C@H](NC(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C25H33NO5/c1-5-18-25(30-6-2,31-7-3)23(27)22(24(28)29-4)26-21(19-14-10-8-11-15-19)20-16-12-9-13-17-20/h5,8-17,21-23,26-27H,1,6-7,18H2,2-4H3/t22-,23-/m0/s1 |
| InChIKey | YGEGSIYVCSHFLY-GOTSBHOMSA-N |
| XLogP | 3.61 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|