About [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate
[4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate (PubChem CID 100962463) has the molecular formula C26H29NO5
and a molecular weight of 435.52 g/mol. Its IUPAC name is [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate.
Molecular Properties
| Compound Name | [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate |
| PubChem CID | 100962463 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate |
| SMILES | C=CCCCOc1ccc(C(=O)Oc2ccc([C@H](C#N)OC(=O)CCCCC)cc2)cc1 |
| InChI | InChI=1S/C26H29NO5/c1-3-5-7-9-25(28)32-24(19-27)20-10-16-23(17-11-20)31-26(29)21-12-14-22(15-13-21)30-18-8-6-4-2/h4,10-17,24H,2-3,5-9,18H2,1H3/t24-/m0/s1 |
| InChIKey | DHFCSJAEOKHVCF-DEOSSOPVSA-N |
| XLogP | 5.94 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate?
The IUPAC name of [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate (CID 100962463) is [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate.
What is the SMILES notation for [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate?
The canonical SMILES for [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate is C=CCCCOc1ccc(C(=O)Oc2ccc([C@H](C#N)OC(=O)CCCCC)cc2)cc1.
What is the InChIKey of [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate?
The InChIKey is DHFCSJAEOKHVCF-DEOSSOPVSA-N. The full InChI is InChI=1S/C26H29NO5/c1-3-5-7-9-25(28)32-24(19-27)20-10-16-23(17-11-20)31-26(29)21-12-14-22(15-13-21)30-18-8-6-4-2/h4,10-17,24H,2-3,5-9,18H2,1H3/t24-/m0/s1.
What are the key properties of [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate?
[4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate has a molecular weight of 435.52 g/mol, XLogP of 5.94, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(R)-cyano(hexanoyloxy)methyl]phenyl] 4-pent-4-enoxybenzoate is sourced from PubChem (CID 100962463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).