C20H29NO10 — CID 100962705
[(1S,5R,6S)-5,6-diacetyloxy-4-[acetyloxy(tritio)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl] acetate (PubChem CID 100962705) has the molecular formula C20H29NO10 and a molecular weight of 445.46 g/mol. Its IUPAC name is [(1S,5R,6S)-5,6-diacetyloxy-4-[acetyloxy(tritio)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,5R,6S)-5,6-diacetyloxy-4-[acetyloxy(tritio)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 100962705 |
| Molecular Formula | C20H29NO10 |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [(1S,5R,6S)-5,6-diacetyloxy-4-[acetyloxy(tritio)methyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl] acetate |
| SMILES | [3H]C(OC(C)=O)C1=CC(NC(=O)OC(C)(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H29NO10/c1-10(22)27-9-14-8-15(21-19(26)31-20(5,6)7)17(29-12(3)24)18(30-13(4)25)16(14)28-11(2)23/h8,15-18H,9H2,1-7H3,(H,21,26)/t15?,16-,17+,18+/m1/s1/i9T/t9?,15?,16-,17+,18+ |
| InChIKey | QUXKJFYRVFDNJP-DDLOGZGUSA-N |
| XLogP | 1.18 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|