C24H8 — CID 100965113
(1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octaethynylcycloocta-1,3,5,7-tetraene (PubChem CID 100965113) has the molecular formula C24H8 and a molecular weight of 296.33 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octaethynylcycloocta-1,3,5,7-tetraene.
| Compound Name | (1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octaethynylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 100965113 |
| Molecular Formula | C24H8 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (1Z,3Z,5Z,7Z)-1,2,3,4,5,6,7,8-octaethynylcycloocta-1,3,5,7-tetraene |
| SMILES | C#CC1=C(C#C)/C(C#C)=C(C#C)\C(C#C)=C(C#C)/C(C#C)=C\1C#C |
| InChI | InChI=1S/C24H8/c1-9-17-18(10-2)20(12-4)22(14-6)24(16-8)23(15-7)21(13-5)19(17)11-3/h1-8H/b18-17-,19-17-,20-18-,21-19-,22-20-,23-21-,24-22-,24-23- |
| InChIKey | MBOUSHZXTWIXFH-VAYXNBRBSA-N |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|