C20H30 — CID 162199007
but-2-yne;(3Z,5Z)-1,2,3,4,5,6,7,8-octamethylcycloocta-1,3,5,7-tetraene (PubChem CID 162199007) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is but-2-yne;(3Z,5Z)-1,2,3,4,5,6,7,8-octamethylcycloocta-1,3,5,7-tetraene.
| Compound Name | but-2-yne;(3Z,5Z)-1,2,3,4,5,6,7,8-octamethylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 162199007 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | but-2-yne;(3Z,5Z)-1,2,3,4,5,6,7,8-octamethylcycloocta-1,3,5,7-tetraene |
| SMILES | CC#CC.CC1=C(C)/C(C)=C(C)\C(C)=C(\C)C(C)=C1C |
| InChI | InChI=1S/C16H24.C4H6/c1-9-10(2)12(4)14(6)16(8)15(7)13(5)11(9)3;1-3-4-2/h1-8H3;1-2H3/b10-9-,11-9-,12-10-,13-11?,14-12?,15-13?,16-14?,16-15?; |
| InChIKey | ZRIFYYPNWKRUIX-NEZVSMQVSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|