C36H36 — CID 154721470
5,6,11,12,17,18-hexa(propan-2-ylidene)cyclooctadeca-1,3,7,9,13,15-hexayne (PubChem CID 154721470) has the molecular formula C36H36 and a molecular weight of 468.68 g/mol. Its IUPAC name is 5,6,11,12,17,18-hexa(propan-2-ylidene)cyclooctadeca-1,3,7,9,13,15-hexayne.
| Compound Name | 5,6,11,12,17,18-hexa(propan-2-ylidene)cyclooctadeca-1,3,7,9,13,15-hexayne |
|---|---|
| PubChem CID | 154721470 |
| Molecular Formula | C36H36 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 5,6,11,12,17,18-hexa(propan-2-ylidene)cyclooctadeca-1,3,7,9,13,15-hexayne |
| SMILES | CC(C)=c1c#cc#cc(=C(C)C)c(=C(C)C)c#cc#cc(=C(C)C)c(=C(C)C)c#cc#cc1=C(C)C |
| InChI | InChI=1S/C36H36/c1-25(2)31-19-13-14-21-33(27(5)6)35(29(9)10)23-17-18-24-36(30(11)12)34(28(7)8)22-16-15-20-32(31)26(3)4/h1-12H3 |
| InChIKey | ZVYCAXLFAWTZGK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |