C24H24 — CID 91342041
(3Z,5Z)-1,2,4,7-tetramethyl-3,5,6,8-tetrakis(prop-1-ynyl)cycloocta-1,3,5,7-tetraene (PubChem CID 91342041) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is (3Z,5Z)-1,2,4,7-tetramethyl-3,5,6,8-tetrakis(prop-1-ynyl)cycloocta-1,3,5,7-tetraene.
| Compound Name | (3Z,5Z)-1,2,4,7-tetramethyl-3,5,6,8-tetrakis(prop-1-ynyl)cycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 91342041 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (3Z,5Z)-1,2,4,7-tetramethyl-3,5,6,8-tetrakis(prop-1-ynyl)cycloocta-1,3,5,7-tetraene |
| SMILES | CC#CC1=C(C)/C(C#CC)=C(C#CC)\C(C)=C(\C#CC)C(C)=C1C |
| InChI | InChI=1S/C24H24/c1-9-13-21-17(5)18(6)22(14-10-2)20(8)24(16-12-4)23(15-11-3)19(21)7/h1-8H3/b18-17?,21-17?,21-19-,22-18?,22-20?,23-19-,24-20?,24-23- |
| InChIKey | FEZZVBJTPIXAPY-VJEHCHSESA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|