C34H44 — CID 135030373
(6E,10E,14E)-6,7,10,11,14,15-hexaethyl-3,18-dimethylideneicosa-6,10,14-trien-4,8,12,16-tetrayne (PubChem CID 135030373) has the molecular formula C34H44 and a molecular weight of 452.73 g/mol. Its IUPAC name is (6E,10E,14E)-6,7,10,11,14,15-hexaethyl-3,18-dimethylideneicosa-6,10,14-trien-4,8,12,16-tetrayne.
| Compound Name | (6E,10E,14E)-6,7,10,11,14,15-hexaethyl-3,18-dimethylideneicosa-6,10,14-trien-4,8,12,16-tetrayne |
|---|---|
| PubChem CID | 135030373 |
| Molecular Formula | C34H44 |
| Molecular Weight | 452.73 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | (6E,10E,14E)-6,7,10,11,14,15-hexaethyl-3,18-dimethylideneicosa-6,10,14-trien-4,8,12,16-tetrayne |
| SMILES | C=C(C#C/C(CC)=C(/C#C/C(CC)=C(/C#C/C(CC)=C(/C#CC(=C)CC)CC)CC)CC)CC |
| InChI | InChI=1S/C34H44/c1-11-27(9)19-21-29(13-3)31(15-5)23-25-33(17-7)34(18-8)26-24-32(16-6)30(14-4)22-20-28(10)12-2/h9-18H2,1-8H3/b31-29+,32-30+,34-33+ |
| InChIKey | NGSLAKRRLUYVDF-VDPLCDLASA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.73 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|