C33H52 — CID 101001219
(5E,9E,13E,17E,21E)-6,10,14,18,22,26-hexamethylheptacosa-5,9,13,17,21,25-hexaen-1-yne (PubChem CID 101001219) has the molecular formula C33H52 and a molecular weight of 448.78 g/mol. Its IUPAC name is (5E,9E,13E,17E,21E)-6,10,14,18,22,26-hexamethylheptacosa-5,9,13,17,21,25-hexaen-1-yne.
| Compound Name | (5E,9E,13E,17E,21E)-6,10,14,18,22,26-hexamethylheptacosa-5,9,13,17,21,25-hexaen-1-yne |
|---|---|
| PubChem CID | 101001219 |
| Molecular Formula | C33H52 |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 448.41 |
| IUPAC Name | (5E,9E,13E,17E,21E)-6,10,14,18,22,26-hexamethylheptacosa-5,9,13,17,21,25-hexaen-1-yne |
| SMILES | C#CCC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C33H52/c1-9-10-11-18-29(4)20-13-22-31(6)24-15-26-33(8)27-16-25-32(7)23-14-21-30(5)19-12-17-28(2)3/h1,17-18,21-22,25-26H,10-16,19-20,23-24,27H2,2-8H3/b29-18+,30-21+,31-22+,32-25+,33-26+ |
| InChIKey | ALIPEORNUPLDQA-VRPJQTMLSA-N |
| XLogP | 11.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|