C18H38 — CID 144536542
ethane;(4Z)-8-methylnona-4,7-dien-1-yne (PubChem CID 144536542) has the molecular formula C18H38 and a molecular weight of 254.50 g/mol. Its IUPAC name is ethane;(4Z)-8-methylnona-4,7-dien-1-yne.
| Compound Name | ethane;(4Z)-8-methylnona-4,7-dien-1-yne |
|---|---|
| PubChem CID | 144536542 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | ethane;(4Z)-8-methylnona-4,7-dien-1-yne |
| SMILES | C#CC/C=C\CC=C(C)C.CC.CC.CC.CC |
| InChI | InChI=1S/C10H14.4C2H6/c1-4-5-6-7-8-9-10(2)3;4*1-2/h1,6-7,9H,5,8H2,2-3H3;4*1-2H3/b7-6-;;;; |
| InChIKey | MJHYWOZOWPSCPJ-VSJPESBJSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|