C48H76 — CID 11479321
(5E,9E,13E,17E,21E,25E,29E,33E)-6,10,14,18,22,26,30,34,38-nonamethylnonatriaconta-5,9,13,17,21,25,29,33,37-nonaen-1-yne (PubChem CID 11479321) has the molecular formula C48H76 and a molecular weight of 653.14 g/mol. Its IUPAC name is (5E,9E,13E,17E,21E,25E,29E,33E)-6,10,14,18,22,26,30,34,38-nonamethylnonatriaconta-5,9,13,17,21,25,29,33,37-nonaen-1-yne.
| Compound Name | (5E,9E,13E,17E,21E,25E,29E,33E)-6,10,14,18,22,26,30,34,38-nonamethylnonatriaconta-5,9,13,17,21,25,29,33,37-nonaen-1-yne |
|---|---|
| PubChem CID | 11479321 |
| Molecular Formula | C48H76 |
| Molecular Weight | 653.14 g/mol |
| Exact Mass | 652.59 |
| IUPAC Name | (5E,9E,13E,17E,21E,25E,29E,33E)-6,10,14,18,22,26,30,34,38-nonamethylnonatriaconta-5,9,13,17,21,25,29,33,37-nonaen-1-yne |
| SMILES | C#CCC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C48H76/c1-12-13-14-24-41(4)26-16-28-43(6)30-18-32-45(8)34-20-36-47(10)38-22-39-48(11)37-21-35-46(9)33-19-31-44(7)29-17-27-42(5)25-15-23-40(2)3/h1,23-24,27-28,31-32,35-36,39H,13-22,25-26,29-30,33-34,37-38H2,2-11H3/b41-24+,42-27+,43-28+,44-31+,45-32+,46-35+,47-36+,48-39+ |
| InChIKey | XVSHRVHZFZRDHM-HHGAMUSGSA-N |
| XLogP | 16.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.14 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|