C24H24 — CID 22949795
(1Z,3Z,5Z,7Z)-1,2,5,6-tetramethyl-3,4,7,8-tetrakis(prop-1-ynyl)cycloocta-1,3,5,7-tetraene (PubChem CID 22949795) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z)-1,2,5,6-tetramethyl-3,4,7,8-tetrakis(prop-1-ynyl)cycloocta-1,3,5,7-tetraene.
| Compound Name | (1Z,3Z,5Z,7Z)-1,2,5,6-tetramethyl-3,4,7,8-tetrakis(prop-1-ynyl)cycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 22949795 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (1Z,3Z,5Z,7Z)-1,2,5,6-tetramethyl-3,4,7,8-tetrakis(prop-1-ynyl)cycloocta-1,3,5,7-tetraene |
| SMILES | CC#CC1=C(C#CC)/C(C)=C(C)\C(C#CC)=C(C#CC)/C(C)=C\1C |
| InChI | InChI=1S/C24H24/c1-9-13-21-17(5)18(6)23(15-11-3)24(16-12-4)20(8)19(7)22(21)14-10-2/h1-8H3/b18-17-,20-19-,21-17-,22-19-,22-21-,23-18-,24-20-,24-23- |
| InChIKey | LMHOJCKJACBQLX-DIZKJUFYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|