C24H36O2Si — CID 100968648
tert-butyl-[3-[2-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)ethynyl]phenoxy]-dimethylsilane (PubChem CID 100968648) has the molecular formula C24H36O2Si and a molecular weight of 384.64 g/mol. Its IUPAC name is tert-butyl-[3-[2-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)ethynyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[2-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)ethynyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 100968648 |
| Molecular Formula | C24H36O2Si |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | tert-butyl-[3-[2-(4-tert-butyl-3,3-dimethyl-2H-furan-5-yl)ethynyl]phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)C1=C(C#Cc2cccc(O[Si](C)(C)C(C)(C)C)c2)OCC1(C)C |
| InChI | InChI=1S/C24H36O2Si/c1-22(2,3)21-20(25-17-24(21,7)8)15-14-18-12-11-13-19(16-18)26-27(9,10)23(4,5)6/h11-13,16H,17H2,1-10H3 |
| InChIKey | KKJSNGAWVBLGEM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|