C24H36O4Si — CID 100968651
tert-butyl-[3-[2-(5-tert-butyl-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)ethynyl]phenoxy]-dimethylsilane (PubChem CID 100968651) has the molecular formula C24H36O4Si and a molecular weight of 416.63 g/mol. Its IUPAC name is tert-butyl-[3-[2-(5-tert-butyl-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)ethynyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[2-(5-tert-butyl-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)ethynyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 100968651 |
| Molecular Formula | C24H36O4Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | tert-butyl-[3-[2-(5-tert-butyl-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl)ethynyl]phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)C12OOC1(C#Cc1cccc(O[Si](C)(C)C(C)(C)C)c1)OCC2(C)C |
| InChI | InChI=1S/C24H36O4Si/c1-20(2,3)24-22(7,8)17-25-23(24,27-28-24)15-14-18-12-11-13-19(16-18)26-29(9,10)21(4,5)6/h11-13,16H,17H2,1-10H3 |
| InChIKey | QOXXSLPPZAQEQW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|