C17H15NO8 — CID 100968994
methyl 2-[1,3-benzodioxol-5-yl-(3,4,5-trihydroxybenzoyl)amino]acetate (PubChem CID 100968994) has the molecular formula C17H15NO8 and a molecular weight of 361.31 g/mol. Its IUPAC name is methyl 2-[1,3-benzodioxol-5-yl-(3,4,5-trihydroxybenzoyl)amino]acetate.
| Compound Name | methyl 2-[1,3-benzodioxol-5-yl-(3,4,5-trihydroxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 100968994 |
| Molecular Formula | C17H15NO8 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | methyl 2-[1,3-benzodioxol-5-yl-(3,4,5-trihydroxybenzoyl)amino]acetate |
| SMILES | COC(=O)CN(C(=O)c1cc(O)c(O)c(O)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15NO8/c1-24-15(21)7-18(10-2-3-13-14(6-10)26-8-25-13)17(23)9-4-11(19)16(22)12(20)5-9/h2-6,19-20,22H,7-8H2,1H3 |
| InChIKey | LTPQUCJVYTUJTI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|