C15H20O4S — CID 100971413
methyl 2-[(2S,4S,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]acetate (PubChem CID 100971413) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is methyl 2-[(2S,4S,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4S,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 100971413 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | methyl 2-[(2S,4S,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H](OC)C[C@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C15H20O4S/c1-17-11-8-12(9-14(16)18-2)19-15(10-11)20-13-6-4-3-5-7-13/h3-7,11-12,15H,8-10H2,1-2H3/t11-,12-,15-/m0/s1 |
| InChIKey | BQCGECNGGXSHMX-HUBLWGQQSA-N |
| XLogP | 2.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |