C7H13N2O4PS — CID 100972551
ethoxy-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]phosphinic acid (PubChem CID 100972551) has the molecular formula C7H13N2O4PS and a molecular weight of 252.23 g/mol. Its IUPAC name is ethoxy-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]phosphinic acid.
| Compound Name | ethoxy-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]phosphinic acid |
|---|---|
| PubChem CID | 100972551 |
| Molecular Formula | C7H13N2O4PS |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | ethoxy-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]phosphinic acid |
| SMILES | CCOP(=O)(O)[C@@H]1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C7H13N2O4PS/c1-2-13-14(11,12)6-5-4(3-15-6)8-7(10)9-5/h4-6H,2-3H2,1H3,(H,11,12)(H2,8,9,10)/t4?,5?,6-/m1/s1 |
| InChIKey | WQCJFPJJUMXWGM-JMMWHDCWSA-N |
| XLogP | 0.33 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|