C19H16BrIN2O — CID 10097290
(3aS,4S,9bS)-4-(5-bromo-1H-indol-3-yl)-8-iodo-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 10097290) has the molecular formula C19H16BrIN2O and a molecular weight of 495.16 g/mol. Its IUPAC name is (3aS,4S,9bS)-4-(5-bromo-1H-indol-3-yl)-8-iodo-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,4S,9bS)-4-(5-bromo-1H-indol-3-yl)-8-iodo-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 10097290 |
| Molecular Formula | C19H16BrIN2O |
| Molecular Weight | 495.16 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | (3aS,4S,9bS)-4-(5-bromo-1H-indol-3-yl)-8-iodo-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | Brc1ccc2[nH]cc([C@H]3Nc4ccc(I)cc4[C@H]4OCC[C@@H]34)c2c1 |
| InChI | InChI=1S/C19H16BrIN2O/c20-10-1-3-16-13(7-10)15(9-22-16)18-12-5-6-24-19(12)14-8-11(21)2-4-17(14)23-18/h1-4,7-9,12,18-19,22-23H,5-6H2/t12-,18-,19-/m0/s1 |
| InChIKey | FVONUNYIIDFNGF-NXXSPTCGSA-N |
| XLogP | 5.78 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.16 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|