C25H31NO5 — CID 100975081
dibutyl (4R,5R)-2,3-diphenyl-1,2-oxazolidine-4,5-dicarboxylate (PubChem CID 100975081) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is dibutyl (4R,5R)-2,3-diphenyl-1,2-oxazolidine-4,5-dicarboxylate.
| Compound Name | dibutyl (4R,5R)-2,3-diphenyl-1,2-oxazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 100975081 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | dibutyl (4R,5R)-2,3-diphenyl-1,2-oxazolidine-4,5-dicarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1C(c2ccccc2)N(c2ccccc2)O[C@H]1C(=O)OCCCC |
| InChI | InChI=1S/C25H31NO5/c1-3-5-17-29-24(27)21-22(19-13-9-7-10-14-19)26(20-15-11-8-12-16-20)31-23(21)25(28)30-18-6-4-2/h7-16,21-23H,3-6,17-18H2,1-2H3/t21-,22?,23-/m1/s1 |
| InChIKey | QHSDJDPIYQTQRG-OJVMETQDSA-N |
| XLogP | 4.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|