C19H30O2Si — CID 100975403
[(6S)-8,8-dimethoxy-6-phenyloct-2-ynyl]-trimethylsilane (PubChem CID 100975403) has the molecular formula C19H30O2Si and a molecular weight of 318.53 g/mol. Its IUPAC name is [(6S)-8,8-dimethoxy-6-phenyloct-2-ynyl]-trimethylsilane.
| Compound Name | [(6S)-8,8-dimethoxy-6-phenyloct-2-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 100975403 |
| Molecular Formula | C19H30O2Si |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | [(6S)-8,8-dimethoxy-6-phenyloct-2-ynyl]-trimethylsilane |
| SMILES | COC(C[C@H](CCC#CC[Si](C)(C)C)c1ccccc1)OC |
| InChI | InChI=1S/C19H30O2Si/c1-20-19(21-2)16-18(17-12-8-6-9-13-17)14-10-7-11-15-22(3,4)5/h6,8-9,12-13,18-19H,10,14-16H2,1-5H3/t18-/m0/s1 |
| InChIKey | PHQRSAKAZWISGV-SFHVURJKSA-N |
| XLogP | 4.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|