C21H28O8 — CID 100980076
dimethyl (1S,2R,5R,6S,7R,10S)-10-acetyloxy-6-(acetyloxymethyl)-6-methyltricyclo[5.3.1.01,5]undec-8-ene-2,8-dicarboxylate (PubChem CID 100980076) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is dimethyl (1S,2R,5R,6S,7R,10S)-10-acetyloxy-6-(acetyloxymethyl)-6-methyltricyclo[5.3.1.01,5]undec-8-ene-2,8-dicarboxylate.
| Compound Name | dimethyl (1S,2R,5R,6S,7R,10S)-10-acetyloxy-6-(acetyloxymethyl)-6-methyltricyclo[5.3.1.01,5]undec-8-ene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 100980076 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | dimethyl (1S,2R,5R,6S,7R,10S)-10-acetyloxy-6-(acetyloxymethyl)-6-methyltricyclo[5.3.1.01,5]undec-8-ene-2,8-dicarboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)=O)[C@@]23C[C@@H]1[C@@](C)(COC(C)=O)[C@H]2CC[C@H]3C(=O)OC |
| InChI | InChI=1S/C21H28O8/c1-11(22)28-10-20(3)15-9-21(14(19(25)27-5)6-7-16(20)21)17(29-12(2)23)8-13(15)18(24)26-4/h8,14-17H,6-7,9-10H2,1-5H3/t14-,15-,16+,17-,20+,21+/m0/s1 |
| InChIKey | PDLQJJKMOWUVSV-VMUILHIYSA-N |
| XLogP | 1.81 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|