C17H30O5Si — CID 100985601
ethyl 5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-2-methylfuran-3-carboxylate (PubChem CID 100985601) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is ethyl 5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 100985601 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethyl 5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypropyl]-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C)oc1C |
| InChI | InChI=1S/C17H30O5Si/c1-9-20-16(19)13-10-14(21-11(13)2)15(18)12(3)22-23(7,8)17(4,5)6/h10,12,15,18H,9H2,1-8H3/t12-,15+/m0/s1 |
| InChIKey | VXRLRLMGTSLUAG-SWLSCSKDSA-N |
| XLogP | 4.21 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|