C29H41NO14SSi — CID 100995941
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(5-nitrothiophen-2-yl)-3,6-dihydro-2H-pyran-6-yl]oxy]oxan-2-yl]methyl acetate (PubChem CID 100995941) has the molecular formula C29H41NO14SSi and a molecular weight of 687.79 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(5-nitrothiophen-2-yl)-3,6-dihydro-2H-pyran-6-yl]oxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(5-nitrothiophen-2-yl)-3,6-dihydro-2H-pyran-6-yl]oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 100995941 |
| Molecular Formula | C29H41NO14SSi |
| Molecular Weight | 687.79 g/mol |
| Exact Mass | 687.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(5-nitrothiophen-2-yl)-3,6-dihydro-2H-pyran-6-yl]oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@@H]2C=C(O[Si](C)(C)C(C)(C)C)C[C@H](c3ccc([N+](=O)[O-])s3)O2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H41NO14SSi/c1-15(31)37-14-21-25(38-16(2)32)26(39-17(3)33)27(40-18(4)34)28(42-21)43-24-13-19(44-46(8,9)29(5,6)7)12-20(41-24)22-10-11-23(45-22)30(35)36/h10-11,13,20-21,24-28H,12,14H2,1-9H3/t20-,21-,24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | IYHFZFSMGZLMTC-QUOQNKLBSA-N |
| XLogP | 4.45 |
| TPSA | 185.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.79 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|