C25H35NO13 — CID 100998819
[(3R,4S,5S,6R)-4,5,6-triacetyloxy-3-[[(2R,3R,4S,5S)-4,5-diacetyloxy-2-methyloxan-3-yl]amino]cyclohexen-1-yl]methyl acetate (PubChem CID 100998819) has the molecular formula C25H35NO13 and a molecular weight of 557.55 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-4,5,6-triacetyloxy-3-[[(2R,3R,4S,5S)-4,5-diacetyloxy-2-methyloxan-3-yl]amino]cyclohexen-1-yl]methyl acetate.
| Compound Name | [(3R,4S,5S,6R)-4,5,6-triacetyloxy-3-[[(2R,3R,4S,5S)-4,5-diacetyloxy-2-methyloxan-3-yl]amino]cyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 100998819 |
| Molecular Formula | C25H35NO13 |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | [(3R,4S,5S,6R)-4,5,6-triacetyloxy-3-[[(2R,3R,4S,5S)-4,5-diacetyloxy-2-methyloxan-3-yl]amino]cyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@@H](NC2[C@@H](C)OC[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H35NO13/c1-11-21(24(38-16(6)31)20(10-33-11)35-13(3)28)26-19-8-18(9-34-12(2)27)22(36-14(4)29)25(39-17(7)32)23(19)37-15(5)30/h8,11,19-26H,9-10H2,1-7H3/t11-,19-,20+,21?,22-,23+,24-,25+/m1/s1 |
| InChIKey | BSGCTRFMYKMIAT-DITOLHNLSA-N |
| XLogP | -0.11 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|