C40H47NO4 — CID 101001960
ethyl (2R,3S)-2-(benzhydrylideneamino)-3-(furan-3-yl)-5-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxypentanoate (PubChem CID 101001960) has the molecular formula C40H47NO4 and a molecular weight of 605.82 g/mol. Its IUPAC name is ethyl (2R,3S)-2-(benzhydrylideneamino)-3-(furan-3-yl)-5-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxypentanoate.
| Compound Name | ethyl (2R,3S)-2-(benzhydrylideneamino)-3-(furan-3-yl)-5-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxypentanoate |
|---|---|
| PubChem CID | 101001960 |
| Molecular Formula | C40H47NO4 |
| Molecular Weight | 605.82 g/mol |
| Exact Mass | 605.35 |
| IUPAC Name | ethyl (2R,3S)-2-(benzhydrylideneamino)-3-(furan-3-yl)-5-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl]oxypentanoate |
| SMILES | CCOC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@@H](CCO[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1)c1ccoc1 |
| InChI | InChI=1S/C40H47NO4/c1-5-44-39(42)38(41-37(30-15-9-6-10-16-30)31-17-11-7-12-18-31)34(32-23-25-43-28-32)24-26-45-36-27-29(2)21-22-35(36)40(3,4)33-19-13-8-14-20-33/h6-20,23,25,28-29,34-36,38H,5,21-22,24,26-27H2,1-4H3/t29-,34+,35-,36-,38-/m1/s1 |
| InChIKey | PYHBBSKIVDCHFM-WTRIYIAOSA-N |
| XLogP | 9.02 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.82 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|